C24H21FN2O5 — CID 59533867
N-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-4-yl]-7-fluoro-1,4-dioxonaphthalene-2-carboxamide (PubChem CID 59533867) has the molecular formula C24H21FN2O5 and a molecular weight of 436.44 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-4-yl]-7-fluoro-1,4-dioxonaphthalene-2-carboxamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-4-yl]-7-fluoro-1,4-dioxonaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 59533867 |
| Molecular Formula | C24H21FN2O5 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-4-yl]-7-fluoro-1,4-dioxonaphthalene-2-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccc3c(c2)OCO3)CC1)C1=CC(=O)c2ccc(F)cc2C1=O |
| InChI | InChI=1S/C24H21FN2O5/c25-15-2-3-17-18(10-15)23(29)19(11-20(17)28)24(30)26-16-5-7-27(8-6-16)12-14-1-4-21-22(9-14)32-13-31-21/h1-4,9-11,16H,5-8,12-13H2,(H,26,30) |
| InChIKey | QBINFJCKZLHEFV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|