C23H31FN2O4 — CID 91912674
N-cyclohexyl-2-[2-(4-fluorophenoxy)acetyl]-8-oxa-2-azaspiro[4.5]decane-4-carboxamide (PubChem CID 91912674) has the molecular formula C23H31FN2O4 and a molecular weight of 418.51 g/mol. Its IUPAC name is N-cyclohexyl-2-[2-(4-fluorophenoxy)acetyl]-8-oxa-2-azaspiro[4.5]decane-4-carboxamide.
| Compound Name | N-cyclohexyl-2-[2-(4-fluorophenoxy)acetyl]-8-oxa-2-azaspiro[4.5]decane-4-carboxamide |
|---|---|
| PubChem CID | 91912674 |
| Molecular Formula | C23H31FN2O4 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | N-cyclohexyl-2-[2-(4-fluorophenoxy)acetyl]-8-oxa-2-azaspiro[4.5]decane-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1CN(C(=O)COc2ccc(F)cc2)CC12CCOCC2 |
| InChI | InChI=1S/C23H31FN2O4/c24-17-6-8-19(9-7-17)30-15-21(27)26-14-20(23(16-26)10-12-29-13-11-23)22(28)25-18-4-2-1-3-5-18/h6-9,18,20H,1-5,10-16H2,(H,25,28) |
| InChIKey | KRFDESDKOYUQCH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |