C20H23N3O2 — CID 91913012
N-[(1R,2S)-2-(2-phenylethylcarbamoyl)cyclopentyl]pyridine-4-carboxamide (PubChem CID 91913012) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[(1R,2S)-2-(2-phenylethylcarbamoyl)cyclopentyl]pyridine-4-carboxamide.
| Compound Name | N-[(1R,2S)-2-(2-phenylethylcarbamoyl)cyclopentyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 91913012 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[(1R,2S)-2-(2-phenylethylcarbamoyl)cyclopentyl]pyridine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCC[C@@H]1C(=O)NCCc1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C20H23N3O2/c24-19(16-10-12-21-13-11-16)23-18-8-4-7-17(18)20(25)22-14-9-15-5-2-1-3-6-15/h1-3,5-6,10-13,17-18H,4,7-9,14H2,(H,22,25)(H,23,24)/t17-,18+/m0/s1 |
| InChIKey | PFNCELRUQCJBNM-ZWKOTPCHSA-N |
| XLogP | 2.34 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |