C21H26N4O2 — CID 91925585
5-methyl-N-[(1R,2S)-2-(3-phenylpropylcarbamoyl)cyclopentyl]pyrazine-2-carboxamide (PubChem CID 91925585) has the molecular formula C21H26N4O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is 5-methyl-N-[(1R,2S)-2-(3-phenylpropylcarbamoyl)cyclopentyl]pyrazine-2-carboxamide.
| Compound Name | 5-methyl-N-[(1R,2S)-2-(3-phenylpropylcarbamoyl)cyclopentyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 91925585 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 5-methyl-N-[(1R,2S)-2-(3-phenylpropylcarbamoyl)cyclopentyl]pyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)N[C@@H]2CCC[C@@H]2C(=O)NCCCc2ccccc2)cn1 |
| InChI | InChI=1S/C21H26N4O2/c1-15-13-24-19(14-23-15)21(27)25-18-11-5-10-17(18)20(26)22-12-6-9-16-7-3-2-4-8-16/h2-4,7-8,13-14,17-18H,5-6,9-12H2,1H3,(H,22,26)(H,25,27)/t17-,18+/m0/s1 |
| InChIKey | AOPMLIDPJSHLFX-ZWKOTPCHSA-N |
| XLogP | 2.43 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|