C21H22N2O — CID 9191575
N-(2,5-dimethylphenyl)-2-ethyl-4-methylquinoline-3-carboxamide (PubChem CID 9191575) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-ethyl-4-methylquinoline-3-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-ethyl-4-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 9191575 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-ethyl-4-methylquinoline-3-carboxamide |
| SMILES | CCc1nc2ccccc2c(C)c1C(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C21H22N2O/c1-5-17-20(15(4)16-8-6-7-9-18(16)22-17)21(24)23-19-12-13(2)10-11-14(19)3/h6-12H,5H2,1-4H3,(H,23,24) |
| InChIKey | MQVMHCGFRQDWQP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |