C26H30N2O3 — CID 91918074
2-(1H-indol-3-yl)-1-(4-phenylmethoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)ethanone (PubChem CID 91918074) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-1-(4-phenylmethoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)ethanone.
| Compound Name | 2-(1H-indol-3-yl)-1-(4-phenylmethoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)ethanone |
|---|---|
| PubChem CID | 91918074 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 2-(1H-indol-3-yl)-1-(4-phenylmethoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)ethanone |
| SMILES | O=C(Cc1c[nH]c2ccccc12)N1CCC2(CC1)CC(OCc1ccccc1)CCO2 |
| InChI | InChI=1S/C26H30N2O3/c29-25(16-21-18-27-24-9-5-4-8-23(21)24)28-13-11-26(12-14-28)17-22(10-15-31-26)30-19-20-6-2-1-3-7-20/h1-9,18,22,27H,10-17,19H2 |
| InChIKey | DGGDRCSRXOSMBR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |