C22H27NO3S — CID 91918087
(3-methylthiophen-2-yl)-(4-phenylmethoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone (PubChem CID 91918087) has the molecular formula C22H27NO3S and a molecular weight of 385.53 g/mol. Its IUPAC name is (3-methylthiophen-2-yl)-(4-phenylmethoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone.
| Compound Name | (3-methylthiophen-2-yl)-(4-phenylmethoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone |
|---|---|
| PubChem CID | 91918087 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (3-methylthiophen-2-yl)-(4-phenylmethoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone |
| SMILES | Cc1ccsc1C(=O)N1CCC2(CC1)CC(OCc1ccccc1)CCO2 |
| InChI | InChI=1S/C22H27NO3S/c1-17-8-14-27-20(17)21(24)23-11-9-22(10-12-23)15-19(7-13-26-22)25-16-18-5-3-2-4-6-18/h2-6,8,14,19H,7,9-13,15-16H2,1H3 |
| InChIKey | SOQMWDOUZBOSJF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |