C14H25N3O4S — CID 91918299
4-(2-methoxyethoxy)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine (PubChem CID 91918299) has the molecular formula C14H25N3O4S and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine.
| Compound Name | 4-(2-methoxyethoxy)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 91918299 |
| Molecular Formula | C14H25N3O4S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 4-(2-methoxyethoxy)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine |
| SMILES | COCCOC1CCN(S(=O)(=O)c2c(C)nn(C)c2C)CC1 |
| InChI | InChI=1S/C14H25N3O4S/c1-11-14(12(2)16(3)15-11)22(18,19)17-7-5-13(6-8-17)21-10-9-20-4/h13H,5-10H2,1-4H3 |
| InChIKey | RXMIKDMELQGNLX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|