C21H28N2O2 — CID 91919018
[3-[1-(cyclohex-3-en-1-ylmethyl)azetidin-3-yl]oxyphenyl]-pyrrolidin-1-ylmethanone (PubChem CID 91919018) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is [3-[1-(cyclohex-3-en-1-ylmethyl)azetidin-3-yl]oxyphenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-[1-(cyclohex-3-en-1-ylmethyl)azetidin-3-yl]oxyphenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 91919018 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | [3-[1-(cyclohex-3-en-1-ylmethyl)azetidin-3-yl]oxyphenyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cccc(OC2CN(CC3CC=CCC3)C2)c1)N1CCCC1 |
| InChI | InChI=1S/C21H28N2O2/c24-21(23-11-4-5-12-23)18-9-6-10-19(13-18)25-20-15-22(16-20)14-17-7-2-1-3-8-17/h1-2,6,9-10,13,17,20H,3-5,7-8,11-12,14-16H2 |
| InChIKey | JUSWSYGWGKXJQX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|