C20H30N2O2S — CID 91919407
1-pyrrolidin-1-yl-2-[9-(thiophen-3-ylmethyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]ethanone (PubChem CID 91919407) has the molecular formula C20H30N2O2S and a molecular weight of 362.54 g/mol. Its IUPAC name is 1-pyrrolidin-1-yl-2-[9-(thiophen-3-ylmethyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]ethanone.
| Compound Name | 1-pyrrolidin-1-yl-2-[9-(thiophen-3-ylmethyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]ethanone |
|---|---|
| PubChem CID | 91919407 |
| Molecular Formula | C20H30N2O2S |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-pyrrolidin-1-yl-2-[9-(thiophen-3-ylmethyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]ethanone |
| SMILES | O=C(CC1CCOC2(CCN(Cc3ccsc3)CC2)C1)N1CCCC1 |
| InChI | InChI=1S/C20H30N2O2S/c23-19(22-7-1-2-8-22)13-17-3-11-24-20(14-17)5-9-21(10-6-20)15-18-4-12-25-16-18/h4,12,16-17H,1-3,5-11,13-15H2 |
| InChIKey | XSULHTYBQQXIMQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |