C19H28N2O2S — CID 97484288
2-cyclopropyl-N-[(5R)-9-(thiophen-3-ylmethyl)-3-oxa-9-azaspiro[5.5]undecan-5-yl]acetamide (PubChem CID 97484288) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(5R)-9-(thiophen-3-ylmethyl)-3-oxa-9-azaspiro[5.5]undecan-5-yl]acetamide.
| Compound Name | 2-cyclopropyl-N-[(5R)-9-(thiophen-3-ylmethyl)-3-oxa-9-azaspiro[5.5]undecan-5-yl]acetamide |
|---|---|
| PubChem CID | 97484288 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-cyclopropyl-N-[(5R)-9-(thiophen-3-ylmethyl)-3-oxa-9-azaspiro[5.5]undecan-5-yl]acetamide |
| SMILES | O=C(CC1CC1)N[C@H]1COCCC12CCN(Cc1ccsc1)CC2 |
| InChI | InChI=1S/C19H28N2O2S/c22-18(11-15-1-2-15)20-17-13-23-9-6-19(17)4-7-21(8-5-19)12-16-3-10-24-14-16/h3,10,14-15,17H,1-2,4-9,11-13H2,(H,20,22)/t17-/m0/s1 |
| InChIKey | ICXLVGIEARGCLV-KRWDZBQOSA-N |
| XLogP | 3.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |