C26H33N3O5S — CID 91919977
1-acetyl-N-[4-oxo-4-[3-(2-phenoxyethyl)pyrrolidin-1-yl]butyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 91919977) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is 1-acetyl-N-[4-oxo-4-[3-(2-phenoxyethyl)pyrrolidin-1-yl]butyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-acetyl-N-[4-oxo-4-[3-(2-phenoxyethyl)pyrrolidin-1-yl]butyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 91919977 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 1-acetyl-N-[4-oxo-4-[3-(2-phenoxyethyl)pyrrolidin-1-yl]butyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)NCCCC(=O)N3CCC(CCOc4ccccc4)C3)ccc21 |
| InChI | InChI=1S/C26H33N3O5S/c1-20(30)29-16-12-22-18-24(9-10-25(22)29)35(32,33)27-14-5-8-26(31)28-15-11-21(19-28)13-17-34-23-6-3-2-4-7-23/h2-4,6-7,9-10,18,21,27H,5,8,11-17,19H2,1H3 |
| InChIKey | HXBPQPNVFJCRIX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|