C21H34N4O3 — CID 91920784
N-cyclohexyl-2-[3-[2-(cyclopentylmethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxamide (PubChem CID 91920784) has the molecular formula C21H34N4O3 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-cyclohexyl-2-[3-[2-(cyclopentylmethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxamide.
| Compound Name | N-cyclohexyl-2-[3-[2-(cyclopentylmethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 91920784 |
| Molecular Formula | C21H34N4O3 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | N-cyclohexyl-2-[3-[2-(cyclopentylmethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCCC1c1nc(CCOCC2CCCC2)no1 |
| InChI | InChI=1S/C21H34N4O3/c26-21(22-17-9-2-1-3-10-17)25-13-6-11-18(25)20-23-19(24-28-20)12-14-27-15-16-7-4-5-8-16/h16-18H,1-15H2,(H,22,26) |
| InChIKey | FRPDENNFFXURNQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|