C22H27N5O3 — CID 91909950
[2-[3-[2-(cyclopentylmethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(1H-indazol-3-yl)methanone (PubChem CID 91909950) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is [2-[3-[2-(cyclopentylmethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(1H-indazol-3-yl)methanone.
| Compound Name | [2-[3-[2-(cyclopentylmethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 91909950 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | [2-[3-[2-(cyclopentylmethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(1H-indazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2ccccc12)N1CCCC1c1nc(CCOCC2CCCC2)no1 |
| InChI | InChI=1S/C22H27N5O3/c28-22(20-16-8-3-4-9-17(16)24-25-20)27-12-5-10-18(27)21-23-19(26-30-21)11-13-29-14-15-6-1-2-7-15/h3-4,8-9,15,18H,1-2,5-7,10-14H2,(H,24,25) |
| InChIKey | KEVQUEFBSTUCOS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 97.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|