C19H27N5O — CID 91921011
(3S,4S)-1-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N,N-dimethyl-4-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine (PubChem CID 91921011) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is (3S,4S)-1-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N,N-dimethyl-4-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine.
| Compound Name | (3S,4S)-1-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N,N-dimethyl-4-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 91921011 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | (3S,4S)-1-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N,N-dimethyl-4-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine |
| SMILES | Cc1nc([C@H]2CCN(Cc3ccc4c(c3)CCO4)C[C@H]2N(C)C)n[nH]1 |
| InChI | InChI=1S/C19H27N5O/c1-13-20-19(22-21-13)16-6-8-24(12-17(16)23(2)3)11-14-4-5-18-15(10-14)7-9-25-18/h4-5,10,16-17H,6-9,11-12H2,1-3H3,(H,20,21,22)/t16-,17+/m0/s1 |
| InChIKey | NAPSIEFXMKPVKW-DLBZAZTESA-N |
| XLogP | 1.97 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |