C14H22N4O3S — CID 91921416
[3-(1-methylsulfonylpiperidin-4-yl)pyrrolidin-1-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 91921416) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is [3-(1-methylsulfonylpiperidin-4-yl)pyrrolidin-1-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [3-(1-methylsulfonylpiperidin-4-yl)pyrrolidin-1-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 91921416 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [3-(1-methylsulfonylpiperidin-4-yl)pyrrolidin-1-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | CS(=O)(=O)N1CCC(C2CCN(C(=O)c3ccn[nH]3)C2)CC1 |
| InChI | InChI=1S/C14H22N4O3S/c1-22(20,21)18-8-4-11(5-9-18)12-3-7-17(10-12)14(19)13-2-6-15-16-13/h2,6,11-12H,3-5,7-10H2,1H3,(H,15,16) |
| InChIKey | IGUOMXGYCJAIGA-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |