C13H20N4O3S — CID 97441070
[(3aR,8aR)-2-ethyl-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 97441070) has the molecular formula C13H20N4O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is [(3aR,8aR)-2-ethyl-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [(3aR,8aR)-2-ethyl-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 97441070 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | [(3aR,8aR)-2-ethyl-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | CCN1C[C@H]2CCN(C(=O)c3ccn[nH]3)CC[C@H]2S1(=O)=O |
| InChI | InChI=1S/C13H20N4O3S/c1-2-17-9-10-4-7-16(8-5-12(10)21(17,19)20)13(18)11-3-6-14-15-11/h3,6,10,12H,2,4-5,7-9H2,1H3,(H,14,15)/t10-,12-/m1/s1 |
| InChIKey | WOEJPJDRBBKPEY-ZYHUDNBSSA-N |
| XLogP | 0.30 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |