C21H29N5O2 — CID 91922741
1-[2-(cyclopropylmethyl)-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]-1-methyl-3-[(4-methylphenyl)methyl]urea (PubChem CID 91922741) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethyl)-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]-1-methyl-3-[(4-methylphenyl)methyl]urea.
| Compound Name | 1-[2-(cyclopropylmethyl)-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]-1-methyl-3-[(4-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 91922741 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 1-[2-(cyclopropylmethyl)-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]-1-methyl-3-[(4-methylphenyl)methyl]urea |
| SMILES | Cc1ccc(CNC(=O)N(C)C2CCc3nn(CC4CC4)c(=O)n3CC2)cc1 |
| InChI | InChI=1S/C21H29N5O2/c1-15-3-5-16(6-4-15)13-22-20(27)24(2)18-9-10-19-23-26(14-17-7-8-17)21(28)25(19)12-11-18/h3-6,17-18H,7-14H2,1-2H3,(H,22,27) |
| InChIKey | FIEVKNUGJUQEHE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |