C18H25N5O2 — CID 91910794
3-[(4-methoxyphenyl)methyl]-1-methyl-1-(3-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)urea (PubChem CID 91910794) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-1-methyl-1-(3-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)urea.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-1-methyl-1-(3-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)urea |
|---|---|
| PubChem CID | 91910794 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-1-methyl-1-(3-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)urea |
| SMILES | COc1ccc(CNC(=O)N(C)C2CCc3nnc(C)n3CC2)cc1 |
| InChI | InChI=1S/C18H25N5O2/c1-13-20-21-17-9-6-15(10-11-23(13)17)22(2)18(24)19-12-14-4-7-16(25-3)8-5-14/h4-5,7-8,15H,6,9-12H2,1-3H3,(H,19,24) |
| InChIKey | UCRABTPIYWLWAJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |