C14H22N4O3 — CID 91923638
3-(2-hydroxyethyl)-N-(2-methoxyethyl)-1-pyrimidin-2-ylpyrrolidine-3-carboxamide (PubChem CID 91923638) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-N-(2-methoxyethyl)-1-pyrimidin-2-ylpyrrolidine-3-carboxamide.
| Compound Name | 3-(2-hydroxyethyl)-N-(2-methoxyethyl)-1-pyrimidin-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 91923638 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 3-(2-hydroxyethyl)-N-(2-methoxyethyl)-1-pyrimidin-2-ylpyrrolidine-3-carboxamide |
| SMILES | COCCNC(=O)C1(CCO)CCN(c2ncccn2)C1 |
| InChI | InChI=1S/C14H22N4O3/c1-21-10-7-15-12(20)14(4-9-19)3-8-18(11-14)13-16-5-2-6-17-13/h2,5-6,19H,3-4,7-11H2,1H3,(H,15,20) |
| InChIKey | LOSPIDDVTZDDBG-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|