C20H28N4O4 — CID 132778074
3-[[[4-methoxy-3-(2-methoxyethoxy)phenyl]methylamino]methyl]-1-pyrimidin-2-ylpyrrolidin-3-ol (PubChem CID 132778074) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-[[[4-methoxy-3-(2-methoxyethoxy)phenyl]methylamino]methyl]-1-pyrimidin-2-ylpyrrolidin-3-ol.
| Compound Name | 3-[[[4-methoxy-3-(2-methoxyethoxy)phenyl]methylamino]methyl]-1-pyrimidin-2-ylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 132778074 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 3-[[[4-methoxy-3-(2-methoxyethoxy)phenyl]methylamino]methyl]-1-pyrimidin-2-ylpyrrolidin-3-ol |
| SMILES | COCCOc1cc(CNCC2(O)CCN(c3ncccn3)C2)ccc1OC |
| InChI | InChI=1S/C20H28N4O4/c1-26-10-11-28-18-12-16(4-5-17(18)27-2)13-21-14-20(25)6-9-24(15-20)19-22-7-3-8-23-19/h3-5,7-8,12,21,25H,6,9-11,13-15H2,1-2H3 |
| InChIKey | YESNXLFMYUZYEP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|