C23H34N4O3 — CID 132778553
3-[[[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]methylamino]methyl]-1-pyridin-2-ylpyrrolidin-3-ol (PubChem CID 132778553) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is 3-[[[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]methylamino]methyl]-1-pyridin-2-ylpyrrolidin-3-ol.
| Compound Name | 3-[[[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]methylamino]methyl]-1-pyridin-2-ylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 132778553 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 3-[[[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]methylamino]methyl]-1-pyridin-2-ylpyrrolidin-3-ol |
| SMILES | COc1cc(CNCC2(O)CCN(c3ccccn3)C2)ccc1OCCCN(C)C |
| InChI | InChI=1S/C23H34N4O3/c1-26(2)12-6-14-30-20-9-8-19(15-21(20)29-3)16-24-17-23(28)10-13-27(18-23)22-7-4-5-11-25-22/h4-5,7-9,11,15,24,28H,6,10,12-14,16-18H2,1-3H3 |
| InChIKey | TZXPHMDEVWFKSJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 70.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|