C21H30N4O4 — CID 129458649
(3R)-3-[[[4-methoxy-3-(2-methoxyethoxy)phenyl]methylamino]methyl]-1-(6-methylpyrimidin-4-yl)pyrrolidin-3-ol (PubChem CID 129458649) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is (3R)-3-[[[4-methoxy-3-(2-methoxyethoxy)phenyl]methylamino]methyl]-1-(6-methylpyrimidin-4-yl)pyrrolidin-3-ol.
| Compound Name | (3R)-3-[[[4-methoxy-3-(2-methoxyethoxy)phenyl]methylamino]methyl]-1-(6-methylpyrimidin-4-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129458649 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (3R)-3-[[[4-methoxy-3-(2-methoxyethoxy)phenyl]methylamino]methyl]-1-(6-methylpyrimidin-4-yl)pyrrolidin-3-ol |
| SMILES | COCCOc1cc(CNC[C@]2(O)CCN(c3cc(C)ncn3)C2)ccc1OC |
| InChI | InChI=1S/C21H30N4O4/c1-16-10-20(24-15-23-16)25-7-6-21(26,14-25)13-22-12-17-4-5-18(28-3)19(11-17)29-9-8-27-2/h4-5,10-11,15,22,26H,6-9,12-14H2,1-3H3/t21-/m1/s1 |
| InChIKey | UOXXSZWNJPDWSU-OAQYLSRUSA-N |
| XLogP | 1.55 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|