C24H36N2O4 — CID 91925338
(4aR,8aR)-N-[(2,3-dimethoxyphenyl)methyl]-1-(3-methylbutyl)-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide (PubChem CID 91925338) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is (4aR,8aR)-N-[(2,3-dimethoxyphenyl)methyl]-1-(3-methylbutyl)-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide.
| Compound Name | (4aR,8aR)-N-[(2,3-dimethoxyphenyl)methyl]-1-(3-methylbutyl)-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide |
|---|---|
| PubChem CID | 91925338 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (4aR,8aR)-N-[(2,3-dimethoxyphenyl)methyl]-1-(3-methylbutyl)-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide |
| SMILES | COc1cccc(CNC(=O)[C@@]23CCCC[C@H]2N(CCC(C)C)C(=O)CC3)c1OC |
| InChI | InChI=1S/C24H36N2O4/c1-17(2)12-15-26-20-10-5-6-13-24(20,14-11-21(26)27)23(28)25-16-18-8-7-9-19(29-3)22(18)30-4/h7-9,17,20H,5-6,10-16H2,1-4H3,(H,25,28)/t20-,24-/m1/s1 |
| InChIKey | IEQCJEPLJAFKNO-HYBUGGRVSA-N |
| XLogP | 3.92 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |