C15H18N2O — CID 919256
1-(3,4,10-trimethyl-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-5-yl)ethanone (PubChem CID 919256) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-(3,4,10-trimethyl-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-5-yl)ethanone.
| Compound Name | 1-(3,4,10-trimethyl-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-5-yl)ethanone |
|---|---|
| PubChem CID | 919256 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 1-(3,4,10-trimethyl-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-5-yl)ethanone |
| SMILES | CC(=O)c1c(C)c(C)c2n1CCn1c(C)ccc1-2 |
| InChI | InChI=1S/C15H18N2O/c1-9-5-6-13-15-11(3)10(2)14(12(4)18)17(15)8-7-16(9)13/h5-6H,7-8H2,1-4H3 |
| InChIKey | HQKCOOIUIHVBDV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|