C24H28ClN3O2 — CID 91926029
3-[4-[2-(3-chlorophenyl)acetyl]piperazin-1-yl]-1-(2-phenylethyl)pyrrolidin-2-one (PubChem CID 91926029) has the molecular formula C24H28ClN3O2 and a molecular weight of 425.96 g/mol. Its IUPAC name is 3-[4-[2-(3-chlorophenyl)acetyl]piperazin-1-yl]-1-(2-phenylethyl)pyrrolidin-2-one.
| Compound Name | 3-[4-[2-(3-chlorophenyl)acetyl]piperazin-1-yl]-1-(2-phenylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 91926029 |
| Molecular Formula | C24H28ClN3O2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-[4-[2-(3-chlorophenyl)acetyl]piperazin-1-yl]-1-(2-phenylethyl)pyrrolidin-2-one |
| SMILES | O=C(Cc1cccc(Cl)c1)N1CCN(C2CCN(CCc3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C24H28ClN3O2/c25-21-8-4-7-20(17-21)18-23(29)27-15-13-26(14-16-27)22-10-12-28(24(22)30)11-9-19-5-2-1-3-6-19/h1-8,17,22H,9-16,18H2 |
| InChIKey | ZXLXAUXCPWWIDH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |