C17H17N2S- — CID 91928151
1-cyclopenta-1,4-dien-1-yl-N-[[2-(4-methylphenyl)-1,3-thiazol-5-yl]methyl]methanamine (PubChem CID 91928151) has the molecular formula C17H17N2S- and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-cyclopenta-1,4-dien-1-yl-N-[[2-(4-methylphenyl)-1,3-thiazol-5-yl]methyl]methanamine.
| Compound Name | 1-cyclopenta-1,4-dien-1-yl-N-[[2-(4-methylphenyl)-1,3-thiazol-5-yl]methyl]methanamine |
|---|---|
| PubChem CID | 91928151 |
| Molecular Formula | C17H17N2S- |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 1-cyclopenta-1,4-dien-1-yl-N-[[2-(4-methylphenyl)-1,3-thiazol-5-yl]methyl]methanamine |
| SMILES | Cc1ccc(-c2ncc(CNCc3cc[cH-]c3)s2)cc1 |
| InChI | InChI=1S/C17H17N2S/c1-13-6-8-15(9-7-13)17-19-12-16(20-17)11-18-10-14-4-2-3-5-14/h2-9,12,18H,10-11H2,1H3/q-1 |
| InChIKey | XGWLQWUCHSDWBG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|