C14H16N- — CID 91928103
1-cyclopenta-1,4-dien-1-yl-N-[(4-methylphenyl)methyl]methanamine (PubChem CID 91928103) has the molecular formula C14H16N- and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-cyclopenta-1,4-dien-1-yl-N-[(4-methylphenyl)methyl]methanamine.
| Compound Name | 1-cyclopenta-1,4-dien-1-yl-N-[(4-methylphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 91928103 |
| Molecular Formula | C14H16N- |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 1-cyclopenta-1,4-dien-1-yl-N-[(4-methylphenyl)methyl]methanamine |
| SMILES | Cc1ccc(CNCc2cc[cH-]c2)cc1 |
| InChI | InChI=1S/C14H16N/c1-12-6-8-14(9-7-12)11-15-10-13-4-2-3-5-13/h2-9,15H,10-11H2,1H3/q-1 |
| InChIKey | ARMBEGSTVOLHOU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|