C20H18N4O3 — CID 91928595
ethyl 4-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate (PubChem CID 91928595) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is ethyl 4-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 91928595 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | ethyl 4-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate |
| SMILES | C=CC(=O)N1CCc2ccc(-c3ncnc4[nH]cc(C(=O)OCC)c34)cc21 |
| InChI | InChI=1S/C20H18N4O3/c1-3-16(25)24-8-7-12-5-6-13(9-15(12)24)18-17-14(20(26)27-4-2)10-21-19(17)23-11-22-18/h3,5-6,9-11H,1,4,7-8H2,2H3,(H,21,22,23) |
| InChIKey | LRCIRMQTPNPPBZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|