C17H14NO5S- — CID 91929127
(6R,7Z)-3-(acetyloxymethyl)-7-benzylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 91929127) has the molecular formula C17H14NO5S- and a molecular weight of 344.37 g/mol. Its IUPAC name is (6R,7Z)-3-(acetyloxymethyl)-7-benzylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6R,7Z)-3-(acetyloxymethyl)-7-benzylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 91929127 |
| Molecular Formula | C17H14NO5S- |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | (6R,7Z)-3-(acetyloxymethyl)-7-benzylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)[O-])N2C(=O)/C(=C/c3ccccc3)[C@H]2SC1 |
| InChI | InChI=1S/C17H15NO5S/c1-10(19)23-8-12-9-24-16-13(7-11-5-3-2-4-6-11)15(20)18(16)14(12)17(21)22/h2-7,16H,8-9H2,1H3,(H,21,22)/p-1/b13-7-/t16-/m1/s1 |
| InChIKey | VGEKZJBJPIFSJW-VXXVJXPCSA-M |
| XLogP | 0.55 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|