C13H8NNaO3S — CID 23677748
sodium (5R,6Z)-6-benzylidene-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 23677748) has the molecular formula C13H8NNaO3S and a molecular weight of 281.27 g/mol. Its IUPAC name is sodium (5R,6Z)-6-benzylidene-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | sodium (5R,6Z)-6-benzylidene-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 23677748 |
| Molecular Formula | C13H8NNaO3S |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | sodium (5R,6Z)-6-benzylidene-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | O=C([O-])C1=CS[C@@H]2/C(=C\c3ccccc3)C(=O)N12.[Na+] |
| InChI | InChI=1S/C13H9NO3S.Na/c15-11-9(6-8-4-2-1-3-5-8)12-14(11)10(7-18-12)13(16)17;/h1-7,12H,(H,16,17);/q;+1/p-1/b9-6-;/t12-;/m1./s1 |
| InChIKey | UQOAWFQROOPGKQ-GOFPZZHSSA-M |
| XLogP | -2.42 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|