C11H14N2O3S — CID 91929675
3-(4-hydroxyphenyl)-2-nitroso-N-(2-sulfanylethyl)propanamide (PubChem CID 91929675) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-nitroso-N-(2-sulfanylethyl)propanamide.
| Compound Name | 3-(4-hydroxyphenyl)-2-nitroso-N-(2-sulfanylethyl)propanamide |
|---|---|
| PubChem CID | 91929675 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-nitroso-N-(2-sulfanylethyl)propanamide |
| SMILES | O=NC(Cc1ccc(O)cc1)C(=O)NCCS |
| InChI | InChI=1S/C11H14N2O3S/c14-9-3-1-8(2-4-9)7-10(13-16)11(15)12-5-6-17/h1-4,10,14,17H,5-7H2,(H,12,15) |
| InChIKey | DEKRIAGBASKZDO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|