C23H26N2O4 — CID 91929846
4-[(1S,7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-N-[(1S,2S)-2-methoxycyclohexyl]benzamide (PubChem CID 91929846) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 4-[(1S,7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-N-[(1S,2S)-2-methoxycyclohexyl]benzamide.
| Compound Name | 4-[(1S,7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-N-[(1S,2S)-2-methoxycyclohexyl]benzamide |
|---|---|
| PubChem CID | 91929846 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 4-[(1S,7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-N-[(1S,2S)-2-methoxycyclohexyl]benzamide |
| SMILES | CO[C@H]1CCCC[C@@H]1NC(=O)c1ccc(-n2c(O)c3c(c2O)[C@H]2C=C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C23H26N2O4/c1-29-18-5-3-2-4-17(18)24-21(26)13-8-10-16(11-9-13)25-22(27)19-14-6-7-15(12-14)20(19)23(25)28/h6-11,14-15,17-18,27-28H,2-5,12H2,1H3,(H,24,26)/t14-,15+,17-,18-/m0/s1 |
| InChIKey | XMNKHFBLUIZPFA-MVJTYMMSSA-N |
| XLogP | 3.72 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|