About benzo[g][1]benzothiole
benzo[g][1]benzothiole (PubChem CID 9193) has the molecular formula C12H8S
and a molecular weight of 184.26 g/mol. Its IUPAC name is benzo[g][1]benzothiole.
Molecular Properties
| Compound Name | benzo[g][1]benzothiole |
| PubChem CID | 9193 |
| Molecular Formula | C12H8S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | benzo[g][1]benzothiole |
| SMILES | c1ccc2c(c1)ccc1ccsc12 |
| InChI | InChI=1S/C12H8S/c1-2-4-11-9(3-1)5-6-10-7-8-13-12(10)11/h1-8H |
| InChIKey | XHYRHAQEXJIVJX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzo[g][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[g][1]benzothiole?
The IUPAC name of benzo[g][1]benzothiole (CID 9193) is benzo[g][1]benzothiole.
What is the SMILES notation for benzo[g][1]benzothiole?
The canonical SMILES for benzo[g][1]benzothiole is c1ccc2c(c1)ccc1ccsc12.
What is the InChIKey of benzo[g][1]benzothiole?
The InChIKey is XHYRHAQEXJIVJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S/c1-2-4-11-9(3-1)5-6-10-7-8-13-12(10)11/h1-8H.
What are the key properties of benzo[g][1]benzothiole?
benzo[g][1]benzothiole has a molecular weight of 184.26 g/mol, XLogP of 4.05, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[g][1]benzothiole is sourced from PubChem (CID 9193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).