C32H30NO6S- — CID 91931100
(2S)-2-[[4-[[5-(4-formylphenyl)furan-2-yl]methoxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 91931100) has the molecular formula C32H30NO6S- and a molecular weight of 556.66 g/mol. Its IUPAC name is (2S)-2-[[4-[[5-(4-formylphenyl)furan-2-yl]methoxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | (2S)-2-[[4-[[5-(4-formylphenyl)furan-2-yl]methoxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 91931100 |
| Molecular Formula | C32H30NO6S- |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | (2S)-2-[[4-[[5-(4-formylphenyl)furan-2-yl]methoxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)c1ccc(COCc2ccc(-c3ccc(C=O)cc3)o2)cc1-c1ccccc1C)C(=O)[O-] |
| InChI | InChI=1S/C32H31NO6S/c1-21-5-3-4-6-26(21)28-17-23(9-13-27(28)31(35)33-29(32(36)37)15-16-40-2)19-38-20-25-12-14-30(39-25)24-10-7-22(18-34)8-11-24/h3-14,17-18,29H,15-16,19-20H2,1-2H3,(H,33,35)(H,36,37)/p-1/t29-/m0/s1 |
| InChIKey | OAOJLQIBUMOZQL-LJAQVGFWSA-M |
| XLogP | 5.05 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|