C29H29NO4 — CID 91932959
N-tert-butyl-3,5-dioxo-2-(2-phenylethyl)-4-(4-phenylphenyl)oxolane-2-carboxamide (PubChem CID 91932959) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is N-tert-butyl-3,5-dioxo-2-(2-phenylethyl)-4-(4-phenylphenyl)oxolane-2-carboxamide.
| Compound Name | N-tert-butyl-3,5-dioxo-2-(2-phenylethyl)-4-(4-phenylphenyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 91932959 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | N-tert-butyl-3,5-dioxo-2-(2-phenylethyl)-4-(4-phenylphenyl)oxolane-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1(CCc2ccccc2)OC(=O)C(c2ccc(-c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C29H29NO4/c1-28(2,3)30-27(33)29(19-18-20-10-6-4-7-11-20)25(31)24(26(32)34-29)23-16-14-22(15-17-23)21-12-8-5-9-13-21/h4-17,24H,18-19H2,1-3H3,(H,30,33) |
| InChIKey | AXARTCGXCFZIKI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|