C25H35NO4 — CID 54693677
N-tert-butyl-3-hydroxy-4-(6-methylhept-5-en-2-yl)-5-oxo-2-(2-phenylethyl)furan-2-carboxamide (PubChem CID 54693677) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is N-tert-butyl-3-hydroxy-4-(6-methylhept-5-en-2-yl)-5-oxo-2-(2-phenylethyl)furan-2-carboxamide.
| Compound Name | N-tert-butyl-3-hydroxy-4-(6-methylhept-5-en-2-yl)-5-oxo-2-(2-phenylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 54693677 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | N-tert-butyl-3-hydroxy-4-(6-methylhept-5-en-2-yl)-5-oxo-2-(2-phenylethyl)furan-2-carboxamide |
| SMILES | CC(C)=CCCC(C)C1=C(O)C(CCc2ccccc2)(C(=O)NC(C)(C)C)OC1=O |
| InChI | InChI=1S/C25H35NO4/c1-17(2)11-10-12-18(3)20-21(27)25(30-22(20)28,23(29)26-24(4,5)6)16-15-19-13-8-7-9-14-19/h7-9,11,13-14,18,27H,10,12,15-16H2,1-6H3,(H,26,29) |
| InChIKey | JHSYOWGHTHLLSW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|