C29H44O2 — CID 3020316
3,3-bis(3,7-dimethylocta-1,6-dien-3-yloxy)propylbenzene (PubChem CID 3020316) has the molecular formula C29H44O2 and a molecular weight of 424.67 g/mol. Its IUPAC name is 3,3-bis(3,7-dimethylocta-1,6-dien-3-yloxy)propylbenzene.
| Compound Name | 3,3-bis(3,7-dimethylocta-1,6-dien-3-yloxy)propylbenzene |
|---|---|
| PubChem CID | 3020316 |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | 3,3-bis(3,7-dimethylocta-1,6-dien-3-yloxy)propylbenzene |
| SMILES | C=CC(C)(CCC=C(C)C)OC(CCc1ccccc1)OC(C)(C=C)CCC=C(C)C |
| InChI | InChI=1S/C29H44O2/c1-9-28(7,22-14-16-24(3)4)30-27(21-20-26-18-12-11-13-19-26)31-29(8,10-2)23-15-17-25(5)6/h9-13,16-19,27H,1-2,14-15,20-23H2,3-8H3 |
| InChIKey | AKQBPDWFCDLKKL-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|