C28H33F6N2OP — CID 10053484
(4S,5S)-2-(3,7-dimethylocta-1,6-dien-3-yloxy)-1,3-dimethyl-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2-diazaphospholidine (PubChem CID 10053484) has the molecular formula C28H33F6N2OP and a molecular weight of 558.55 g/mol. Its IUPAC name is (4S,5S)-2-(3,7-dimethylocta-1,6-dien-3-yloxy)-1,3-dimethyl-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2-diazaphospholidine.
| Compound Name | (4S,5S)-2-(3,7-dimethylocta-1,6-dien-3-yloxy)-1,3-dimethyl-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2-diazaphospholidine |
|---|---|
| PubChem CID | 10053484 |
| Molecular Formula | C28H33F6N2OP |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | (4S,5S)-2-(3,7-dimethylocta-1,6-dien-3-yloxy)-1,3-dimethyl-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2-diazaphospholidine |
| SMILES | C=CC(C)(CCC=C(C)C)OP1N(C)[C@@H](c2cccc(C(F)(F)F)c2)[C@H](c2cccc(C(F)(F)F)c2)N1C |
| InChI | InChI=1S/C28H33F6N2OP/c1-7-26(4,16-10-11-19(2)3)37-38-35(5)24(20-12-8-14-22(17-20)27(29,30)31)25(36(38)6)21-13-9-15-23(18-21)28(32,33)34/h7-9,11-15,17-18,24-25H,1,10,16H2,2-6H3/t24-,25-,26?/m0/s1 |
| InChIKey | ZBAXVPYHHRDQCD-NPGWBMRXSA-N |
| XLogP | 9.32 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|