C28H29F6N2OP — CID 10460313
(4S,5S)-1,3-dimethyl-2-(2-phenylbutan-2-yloxy)-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2-diazaphospholidine (PubChem CID 10460313) has the molecular formula C28H29F6N2OP and a molecular weight of 554.52 g/mol. Its IUPAC name is (4S,5S)-1,3-dimethyl-2-(2-phenylbutan-2-yloxy)-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2-diazaphospholidine.
| Compound Name | (4S,5S)-1,3-dimethyl-2-(2-phenylbutan-2-yloxy)-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2-diazaphospholidine |
|---|---|
| PubChem CID | 10460313 |
| Molecular Formula | C28H29F6N2OP |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | (4S,5S)-1,3-dimethyl-2-(2-phenylbutan-2-yloxy)-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2-diazaphospholidine |
| SMILES | CCC(C)(OP1N(C)[C@@H](c2cccc(C(F)(F)F)c2)[C@H](c2cccc(C(F)(F)F)c2)N1C)c1ccccc1 |
| InChI | InChI=1S/C28H29F6N2OP/c1-5-26(2,21-13-7-6-8-14-21)37-38-35(3)24(19-11-9-15-22(17-19)27(29,30)31)25(36(38)4)20-12-10-16-23(18-20)28(32,33)34/h6-18,24-25H,5H2,1-4H3/t24-,25-,26?/m0/s1 |
| InChIKey | KIHRAHVABUGYGP-NPGWBMRXSA-N |
| XLogP | 8.95 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|