C25H23F6N2OPSe — CID 10054169
(4S,5S)-2-[deuterio(phenyl)methoxy]-1,3-dimethyl-2-selanylidene-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2lambda5-diazaphospholidine (PubChem CID 10054169) has the molecular formula C25H23F6N2OPSe and a molecular weight of 592.40 g/mol. Its IUPAC name is (4S,5S)-2-[deuterio(phenyl)methoxy]-1,3-dimethyl-2-selanylidene-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2lambda5-diazaphospholidine.
| Compound Name | (4S,5S)-2-[deuterio(phenyl)methoxy]-1,3-dimethyl-2-selanylidene-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2lambda5-diazaphospholidine |
|---|---|
| PubChem CID | 10054169 |
| Molecular Formula | C25H23F6N2OPSe |
| Molecular Weight | 592.40 g/mol |
| Exact Mass | 593.07 |
| IUPAC Name | (4S,5S)-2-[deuterio(phenyl)methoxy]-1,3-dimethyl-2-selanylidene-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2lambda5-diazaphospholidine |
| SMILES | [2H]C(OP1(=[Se])N(C)[C@@H](c2cccc(C(F)(F)F)c2)[C@H](c2cccc(C(F)(F)F)c2)N1C)c1ccccc1 |
| InChI | InChI=1S/C25H23F6N2OPSe/c1-32-22(18-10-6-12-20(14-18)24(26,27)28)23(19-11-7-13-21(15-19)25(29,30)31)33(2)35(32,36)34-16-17-8-4-3-5-9-17/h3-15,22-23H,16H2,1-2H3/t22-,23-/m0/s1/i16D/t16?,22-,23- |
| InChIKey | MYYSREBRVZIWLI-JCRVGWLFSA-N |
| XLogP | 7.45 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.40 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|