C28H30F6N3OPSe — CID 10372052
(1R,2S)-1-[[(4S,5S)-1,3-dimethyl-2-selanylidene-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2λ5-diazaphospholidin-2-yl]oxy]-N-methyl-1-phenylpropan-2-amine (PubChem CID 10372052) has the molecular formula C28H30F6N3OPSe and a molecular weight of 648.49 g/mol. Its IUPAC name is (1R,2S)-1-[[(4S,5S)-1,3-dimethyl-2-selanylidene-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2λ5-diazaphospholidin-2-yl]oxy]-N-methyl-1-phenylpropan-2-amine.
| Compound Name | (1R,2S)-1-[[(4S,5S)-1,3-dimethyl-2-selanylidene-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2λ5-diazaphospholidin-2-yl]oxy]-N-methyl-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 10372052 |
| Molecular Formula | C28H30F6N3OPSe |
| Molecular Weight | 648.49 g/mol |
| Exact Mass | 649.12 |
| IUPAC Name | (1R,2S)-1-[[(4S,5S)-1,3-dimethyl-2-selanylidene-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2λ5-diazaphospholidin-2-yl]oxy]-N-methyl-1-phenylpropan-2-amine |
| SMILES | CN[C@@H](C)[C@H](OP1(=[Se])N(C)[C@@H](c2cccc(C(F)(F)F)c2)[C@H](c2cccc(C(F)(F)F)c2)N1C)c1ccccc1 |
| InChI | InChI=1S/C28H30F6N3OPSe/c1-18(35-2)26(19-10-6-5-7-11-19)38-39(40)36(3)24(20-12-8-14-22(16-20)27(29,30)31)25(37(39)4)21-13-9-15-23(17-21)28(32,33)34/h5-18,24-26,35H,1-4H3/t18-,24-,25-,26-/m0/s1 |
| InChIKey | GDAJLYJONUCHIK-UZTPZCRESA-N |
| XLogP | 7.60 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.49 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|