C28H33F6N2O5P — CID 101160718
diethyl (3S)-3-[[(4R,5R)-1,3-dimethyl-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2-diazaphospholidin-2-yl]oxy]hexanedioate (PubChem CID 101160718) has the molecular formula C28H33F6N2O5P and a molecular weight of 622.54 g/mol. Its IUPAC name is diethyl (3S)-3-[[(4R,5R)-1,3-dimethyl-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2-diazaphospholidin-2-yl]oxy]hexanedioate.
| Compound Name | diethyl (3S)-3-[[(4R,5R)-1,3-dimethyl-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2-diazaphospholidin-2-yl]oxy]hexanedioate |
|---|---|
| PubChem CID | 101160718 |
| Molecular Formula | C28H33F6N2O5P |
| Molecular Weight | 622.54 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | diethyl (3S)-3-[[(4R,5R)-1,3-dimethyl-4,5-bis[3-(trifluoromethyl)phenyl]-1,3,2-diazaphospholidin-2-yl]oxy]hexanedioate |
| SMILES | CCOC(=O)CC[C@@H](CC(=O)OCC)OP1N(C)[C@H](c2cccc(C(F)(F)F)c2)[C@@H](c2cccc(C(F)(F)F)c2)N1C |
| InChI | InChI=1S/C28H33F6N2O5P/c1-5-39-23(37)14-13-22(17-24(38)40-6-2)41-42-35(3)25(18-9-7-11-20(15-18)27(29,30)31)26(36(42)4)19-10-8-12-21(16-19)28(32,33)34/h7-12,15-16,22,25-26H,5-6,13-14,17H2,1-4H3/t22-,25+,26+/m0/s1 |
| InChIKey | SBCCLYHXBWVWFW-HDYLNDSGSA-N |
| XLogP | 7.29 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.54 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|