C36H48O4 — CID 175834333
3,7-dimethylocta-1,6-dien-3-yl 2-phenylacetate;3-ethenyl-3,7-dimethyl-2-phenyloct-6-enoic acid (PubChem CID 175834333) has the molecular formula C36H48O4 and a molecular weight of 544.78 g/mol. Its IUPAC name is 3,7-dimethylocta-1,6-dien-3-yl 2-phenylacetate;3-ethenyl-3,7-dimethyl-2-phenyloct-6-enoic acid.
| Compound Name | 3,7-dimethylocta-1,6-dien-3-yl 2-phenylacetate;3-ethenyl-3,7-dimethyl-2-phenyloct-6-enoic acid |
|---|---|
| PubChem CID | 175834333 |
| Molecular Formula | C36H48O4 |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | 3,7-dimethylocta-1,6-dien-3-yl 2-phenylacetate;3-ethenyl-3,7-dimethyl-2-phenyloct-6-enoic acid |
| SMILES | C=CC(C)(CCC=C(C)C)C(C(=O)O)c1ccccc1.C=CC(C)(CCC=C(C)C)OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/2C18H24O2/c1-5-18(4,13-9-10-15(2)3)20-17(19)14-16-11-7-6-8-12-16;1-5-18(4,13-9-10-14(2)3)16(17(19)20)15-11-7-6-8-12-15/h5-8,10-12H,1,9,13-14H2,2-4H3;5-8,10-12,16H,1,9,13H2,2-4H3,(H,19,20) |
| InChIKey | SNVYAXVCROQGTG-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|