C23H36N2O2S — CID 164673983
[[(2S,3R)-1-(benzylamino)-3-ethenyl-3,7-dimethyl-1-oxooct-6-en-2-yl]amino]-tert-butyl-oxidosulfanium (PubChem CID 164673983) has the molecular formula C23H36N2O2S and a molecular weight of 404.62 g/mol. Its IUPAC name is [[(2S,3R)-1-(benzylamino)-3-ethenyl-3,7-dimethyl-1-oxooct-6-en-2-yl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(2S,3R)-1-(benzylamino)-3-ethenyl-3,7-dimethyl-1-oxooct-6-en-2-yl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 164673983 |
| Molecular Formula | C23H36N2O2S |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | [[(2S,3R)-1-(benzylamino)-3-ethenyl-3,7-dimethyl-1-oxooct-6-en-2-yl]amino]-tert-butyl-oxidosulfanium |
| SMILES | C=C[C@@](C)(CCC=C(C)C)[C@H](N[S+]([O-])C(C)(C)C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H36N2O2S/c1-8-23(7,16-12-13-18(2)3)20(25-28(27)22(4,5)6)21(26)24-17-19-14-10-9-11-15-19/h8-11,13-15,20,25H,1,12,16-17H2,2-7H3,(H,24,26)/t20-,23+,28?/m1/s1 |
| InChIKey | UXRCGFHLBNNAHB-KTOGENSVSA-N |
| XLogP | 4.66 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|