C18H29NO4 — CID 54693661
N-tert-butyl-3-hydroxy-2-methyl-4-(6-methylhept-5-en-2-yl)-5-oxofuran-2-carboxamide (PubChem CID 54693661) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is N-tert-butyl-3-hydroxy-2-methyl-4-(6-methylhept-5-en-2-yl)-5-oxofuran-2-carboxamide.
| Compound Name | N-tert-butyl-3-hydroxy-2-methyl-4-(6-methylhept-5-en-2-yl)-5-oxofuran-2-carboxamide |
|---|---|
| PubChem CID | 54693661 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N-tert-butyl-3-hydroxy-2-methyl-4-(6-methylhept-5-en-2-yl)-5-oxofuran-2-carboxamide |
| SMILES | CC(C)=CCCC(C)C1=C(O)C(C)(C(=O)NC(C)(C)C)OC1=O |
| InChI | InChI=1S/C18H29NO4/c1-11(2)9-8-10-12(3)13-14(20)18(7,23-15(13)21)16(22)19-17(4,5)6/h9,12,20H,8,10H2,1-7H3,(H,19,22) |
| InChIKey | QREAEZAFMNDZBA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|