C14H17ClN4O2 — CID 91938638
1-[(2-chlorophenyl)methyl]-5-methoxy-N-propan-2-yltriazole-4-carboxamide (PubChem CID 91938638) has the molecular formula C14H17ClN4O2 and a molecular weight of 308.77 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-5-methoxy-N-propan-2-yltriazole-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-5-methoxy-N-propan-2-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 91938638 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-5-methoxy-N-propan-2-yltriazole-4-carboxamide |
| SMILES | COc1c(C(=O)NC(C)C)nnn1Cc1ccccc1Cl |
| InChI | InChI=1S/C14H17ClN4O2/c1-9(2)16-13(20)12-14(21-3)19(18-17-12)8-10-6-4-5-7-11(10)15/h4-7,9H,8H2,1-3H3,(H,16,20) |
| InChIKey | KMXJLPRLWCBGHY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |