C20H19N3OS2 — CID 91942531
N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-3-(2,4,5-trimethylphenyl)prop-2-enamide (PubChem CID 91942531) has the molecular formula C20H19N3OS2 and a molecular weight of 381.53 g/mol. Its IUPAC name is N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-3-(2,4,5-trimethylphenyl)prop-2-enamide.
| Compound Name | N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-3-(2,4,5-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 91942531 |
| Molecular Formula | C20H19N3OS2 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-3-(2,4,5-trimethylphenyl)prop-2-enamide |
| SMILES | Cc1cc(C)c(C=CC(=O)Nc2ccc(Sc3nncs3)cc2)cc1C |
| InChI | InChI=1S/C20H19N3OS2/c1-13-10-15(3)16(11-14(13)2)4-9-19(24)22-17-5-7-18(8-6-17)26-20-23-21-12-25-20/h4-12H,1-3H3,(H,22,24) |
| InChIKey | YRSQBHNGNIIAKO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|