C17H10ClFN4O3S2 — CID 72686158
N-[3-chloro-4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-3-(4-fluoro-2-nitrophenyl)prop-2-enamide (PubChem CID 72686158) has the molecular formula C17H10ClFN4O3S2 and a molecular weight of 436.88 g/mol. Its IUPAC name is N-[3-chloro-4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-3-(4-fluoro-2-nitrophenyl)prop-2-enamide.
| Compound Name | N-[3-chloro-4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-3-(4-fluoro-2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 72686158 |
| Molecular Formula | C17H10ClFN4O3S2 |
| Molecular Weight | 436.88 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | N-[3-chloro-4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-3-(4-fluoro-2-nitrophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(F)cc1[N+](=O)[O-])Nc1ccc(Sc2nncs2)c(Cl)c1 |
| InChI | InChI=1S/C17H10ClFN4O3S2/c18-13-8-12(4-5-15(13)28-17-22-20-9-27-17)21-16(24)6-2-10-1-3-11(19)7-14(10)23(25)26/h1-9H,(H,21,24) |
| InChIKey | VEPLSGDDFSGVSI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.88 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|