C18H15F2N3O4 — CID 103599047
4-fluoro-N-[2-[3-(4-fluoro-2-nitrophenyl)prop-2-enoylamino]ethyl]benzamide (PubChem CID 103599047) has the molecular formula C18H15F2N3O4 and a molecular weight of 375.33 g/mol. Its IUPAC name is 4-fluoro-N-[2-[3-(4-fluoro-2-nitrophenyl)prop-2-enoylamino]ethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-[3-(4-fluoro-2-nitrophenyl)prop-2-enoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 103599047 |
| Molecular Formula | C18H15F2N3O4 |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 4-fluoro-N-[2-[3-(4-fluoro-2-nitrophenyl)prop-2-enoylamino]ethyl]benzamide |
| SMILES | O=C(C=Cc1ccc(F)cc1[N+](=O)[O-])NCCNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15F2N3O4/c19-14-5-2-13(3-6-14)18(25)22-10-9-21-17(24)8-4-12-1-7-15(20)11-16(12)23(26)27/h1-8,11H,9-10H2,(H,21,24)(H,22,25) |
| InChIKey | JYCWLEXYPPASEJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|